#
# ISC License
#
# Copyright (c) 2021, Autonomous Vehicle Systems Lab, University of Colorado at Boulder
#
# Permission to use, copy, modify, and/or distribute this software for any
# purpose with or without fee is hereby granted, provided that the above
# copyright notice and this permission notice appear in all copies.
#
# THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
# WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
# MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
# ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
# WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
# ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
# OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
#
r"""
Overview
--------
This script sets up a 6-DOF spacecraft which is orbiting the Earth, in the presence of the Sun.
The spacecraft is modelled according to the specifics of the Bevo-2 satellite, that has a sensitive
star tracker aligned with the x body axis and two sun sensors aligned with the y and z body axes.
In contrast with :ref:`scenarioAttitudeConstraintViolation` the goal of this scenario is to illustrate
how to set up a Basilisk simulation using the :ref:`constrainedAttitudeManeuver` module to perform a
slew maneuver while ensuring constraint compliance.
The script is found in the folder ``basilisk/examples`` and executed by using::
python3 scenarioAttitudeConstrainedManeuver.py
This simulation is set up identically to :ref:`scenarioAttitudeConstraintViolation`. The reader is referred
to this scenario for a detailed description of the setup. The only difference in this scenario is that the
constraint-naive :ref:`inertial3D` module for attitude pointing is replaced with the :ref:`constrainedAttitudeManeuver`
module.
Illustration of Simulation Results
----------------------------------
Each run of the script produces 6 figures. Figures 1-4 report, respectively, attitude error, RW motor torque, rate
tracking error, and RW speed. These plots are only relevant to the spacecraft / RW dynamics. Figures 5 and 6
show the angle between the boresight vector of the star tracker and the Sun (fig. 5), and of the sun sensor(s) and
the Sun (fig. 6). Each plot features a dashed line that represents an angular threshold for that specific instrument.
Each plot describes a slew maneuver performed from an initial inertial attitude :math:`\sigma_{\mathcal{B/N},i}` to
a final inertial attitude :math:`\sigma_{\mathcal{B/N},f}`. In :ref:`scenarioAttitudeConstraintViolation`, these
sets of attitudes and constraints were chosen to highlight specific constraint violations. This scenario shows how,
using :ref:`constrainedAttitudeManeuver`, the constraints are not violated.
::
show_plots = True, use2SunSensors = False, starTrackerFov = 20, sunSensorFov = 70, attitudeSetCase = 0
This case features the violation of the keep in constraint of the sun sensor only when :ref:`inertial3D` is used.
Just for this case, only the sun sensor along the y body axis is considered. Now, the keep in constraint is not violated
as the boresight angle never exceeds the 70 def field of view of the instrument.
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver5020700.svg
:align: center
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver6020700.svg
:align: center
::
show_plots = True, use2SunSensors = True, starTrackerFov = 20, sunSensorFov = 70, attitudeSetCase = 1
In this case, using :ref:`inertial3D`, both the sun sensor boresights exceed the respective thresholds.
In this scenario, however, they do not.
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver5120701.svg
:align: center
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver6120701.svg
:align: center
::
show_plots = True, use2SunSensors = True, starTrackerFov = 20, sunSensorFov = 70, attitudeSetCase = 2
In this case, :ref:`inertial3D` violates the keep out constraint of the star tracker, alongside with the keep in
constraints for both the sun sensors. The following simulation shows how all the constraints are respected.
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver5120702.svg
:align: center
.. image:: /_images/Scenarios/scenarioAttitudeConstrainedManeuver6120702.svg
:align: center
"""
import os
import matplotlib.pyplot as plt
import matplotlib.transforms as mtransforms
import numpy as np
from Basilisk import __path__
from Basilisk.architecture import messaging
from Basilisk.fswAlgorithms import (mrpFeedback, attTrackingError, constrainedAttitudeManeuver, rwMotorTorque)
from Basilisk.simulation import (reactionWheelStateEffector, simpleNav, spacecraft, boreAngCalc)
from Basilisk.utilities import (SimulationBaseClass, macros,
orbitalMotion, simIncludeGravBody,
simIncludeRW, unitTestSupport, vizSupport)
bskPath = __path__[0]
fileName = os.path.basename(os.path.splitext(__file__)[0])
def run(show_plots, use2SunSensors, starTrackerFov, sunSensorFov, attitudeSetCase):
# Create simulation variable names
simTaskName = "simTask"
simProcessName = "simProcess"
# Create a sim module as an empty container
scSim = SimulationBaseClass.SimBaseClass()
scSim.SetProgressBar(False)
# create the simulation process
dynProcess = scSim.CreateNewProcess(simProcessName)
# create the dynamics task and specify the simulation time and integration update time
simulationTime = macros.min2nano(3.5)
simulationTimeStep = macros.sec2nano(0.01)
dynProcess.addTask(scSim.CreateNewTask(simTaskName, simulationTimeStep))
#
# setup the simulation tasks/objects
#
# initialize spacecraft object and set properties
scObject = spacecraft.Spacecraft()
scObject.ModelTag = "Bevo2-Sat"
# add spacecraft object to the simulation process
scSim.AddModelToTask(simTaskName, scObject, 1)
# setup Gravity Body
gravFactory = simIncludeGravBody.gravBodyFactory()
# Next a series of gravitational bodies are included
gravBodies = gravFactory.createBodies('earth', 'sun')
planet = gravBodies['earth']
planet.isCentralBody = True
mu = planet.mu
# The configured gravitational bodies are added to the spacecraft dynamics with the usual command:
gravFactory.addBodiesTo(scObject)
# Next, the default SPICE support module is created and configured.
timeInitString = "2021 JANUARY 15 00:28:30.0"
# The following is a support macro that creates a `spiceObject` instance
spiceObject = gravFactory.createSpiceInterface(time=timeInitString, epochInMsg=True)
# Earth is gravity center
spiceObject.zeroBase = 'Earth'
# The SPICE object is added to the simulation task list.
scSim.AddModelToTask(simTaskName, gravFactory.spiceObject, 2)
# The gravitational body is connected to the spacecraft object
gravFactory.addBodiesTo(scObject)
# setup the orbit using classical orbit elements
oe = orbitalMotion.ClassicElements()
oe.a = 7000. * 1000 # meters
oe.e = 0.0001
oe.i = 33.3 * macros.D2R
oe.Omega = 148.2 * macros.D2R
oe.omega = 347.8 * macros.D2R
oe.f = 135 * macros.D2R
rN, vN = orbitalMotion.elem2rv(mu, oe)
# sets of initial attitudes that yield the desired constraint violations (attitudeSetCase)
sigma_BN_start = [ [0.522, -0.065, 0.539], # to violate one keepIn only
[0.314, -0.251, 0.228], # to violate two keepIn and not keepOut
[-0.378, 0.119, -0.176], # to violate keepOut and both keepIn
[-0.412, 0.044, -0.264] ] # to violate keepOut only
# To set the spacecraft initial conditions, the following initial position and velocity variables are set:
scObject.hub.r_CN_NInit = rN # m - r_BN_N
scObject.hub.v_CN_NInit = vN # m/s - v_BN_N
scObject.hub.sigma_BNInit = sigma_BN_start[attitudeSetCase] # MRP set to customize initial inertial attitude
scObject.hub.omega_BN_BInit = [[0.], [0.], [0.]] # rad/s - omega_CN_B
# define the simulation inertia
I = [0.02 / 3, 0., 0.,
0., 0.1256 / 3, 0.,
0., 0., 0.1256 / 3]
scObject.hub.mHub = 4.0 # kg - spacecraft mass
scObject.hub.r_BcB_B = [[0.0], [0.0], [0.0]] # m - position vector of body-fixed point B relative to CM
scObject.hub.IHubPntBc_B = unitTestSupport.np2EigenMatrix3d(I)
#
# add RW devices
#
# Make RW factory instance
rwFactory = simIncludeRW.rwFactory()
# store the RW dynamical model type
varRWModel = messaging.BalancedWheels
# create each RW by specifying the RW type, the spin axis gsHat, plus optional arguments
maxMomentum = 0.01
maxSpeed = 6000 * macros.RPM
RW1 = rwFactory.create('custom', [1, 0, 0], Omega=0. # RPM
, Omega_max=maxSpeed
, maxMomentum=maxMomentum
, u_max=0.001
, RWModel=varRWModel)
RW2 = rwFactory.create('custom', [0, 1, 0], Omega=0. # RPM
, Omega_max=maxSpeed
, maxMomentum=maxMomentum
, u_max=0.001
, RWModel=varRWModel)
RW3 = rwFactory.create('custom', [0, 0, 1], Omega=0. # RPM
, Omega_max=maxSpeed
, maxMomentum=maxMomentum
, u_max=0.001
, RWModel=varRWModel)
numRW = rwFactory.getNumOfDevices()
# create RW object container and tie to spacecraft object
rwStateEffector = reactionWheelStateEffector.ReactionWheelStateEffector()
rwStateEffector.ModelTag = "RW_cluster"
rwFactory.addToSpacecraft(scObject.ModelTag, rwStateEffector, scObject)
# add RW object array to the simulation process
scSim.AddModelToTask(simTaskName, rwStateEffector, 2)
# add the simple Navigation sensor module
sNavObject = simpleNav.SimpleNav()
sNavObject.ModelTag = "SimpleNavigation"
scSim.AddModelToTask(simTaskName, sNavObject)
#
# setup the FSW algorithm tasks
#
# sets of initial attitudes that yield the desired constraint violations (attitudeSetCase)
sigma_BN_target = [ [0.342, 0.223, -0.432], # to violate one keepIn only
[0.326, -0.206, -0.823], # to violate two keepIn and not keepOut
[0.350, 0.220, -0.440], # to violate keepOut and both keepIn
[0.350, 0.220, -0.440] ] # to violate keepOut only
# setup readManeuver guidance module
CAM = constrainedAttitudeManeuver.ConstrainedAttitudeManeuver(8)
CAM.ModelTag = "constrainedAttitudeManeuvering"
CAM.sigma_BN_goal = sigma_BN_target[attitudeSetCase]
CAM.omega_BN_B_goal = [0, 0, 0]
CAM.avgOmega = 0.04
CAM.BSplineType = 0
CAM.costFcnType = 1
CAM.appendKeepOutDirection([1,0,0], starTrackerFov*macros.D2R)
CAM.appendKeepInDirection([0,1,0], sunSensorFov*macros.D2R)
scSim.AddModelToTask(simTaskName, CAM)
# setup the attitude tracking error evaluation module
attError = attTrackingError.attTrackingError()
attError.ModelTag = "attErrorInertial3D"
scSim.AddModelToTask(simTaskName, attError)
# setup the MRP Feedback control module
mrpControl = mrpFeedback.mrpFeedback()
mrpControl.ModelTag = "mrpFeedback"
scSim.AddModelToTask(simTaskName, mrpControl)
decayTime = 10.0
xi = 1.0
mrpControl.Ki = -1 # make value negative to turn off integral feedback
mrpControl.P = 3*np.max(I)/decayTime
mrpControl.K = (mrpControl.P/xi)*(mrpControl.P/xi)/np.max(I)
mrpControl.integralLimit = 2. / mrpControl.Ki * 0.1
# add module that maps the Lr control torque into the RW motor torques
rwMotorTorqueObj = rwMotorTorque.rwMotorTorque()
rwMotorTorqueObj.ModelTag = "rwMotorTorque"
scSim.AddModelToTask(simTaskName, rwMotorTorqueObj)
# Make the RW control all three body axes
controlAxes_B = [1, 0, 0, 0, 1, 0, 0, 0, 1]
rwMotorTorqueObj.controlAxes_B = controlAxes_B
# Boresight vector modules.
stBACObject = boreAngCalc.BoreAngCalc()
stBACObject.ModelTag = "starTrackerBoresight"
stBACObject.boreVec_B = [1., 0., 0.] # boresight in body frame
scSim.AddModelToTask(simTaskName, stBACObject)
ssyBACObject = boreAngCalc.BoreAngCalc()
ssyBACObject.ModelTag = "SunSensorBoresight"
ssyBACObject.boreVec_B = [0., 1., 0.] # boresight in body frame
scSim.AddModelToTask(simTaskName, ssyBACObject)
if use2SunSensors:
CAM.appendKeepInDirection([0,0,1], sunSensorFov*macros.D2R)
sszBACObject = boreAngCalc.BoreAngCalc()
sszBACObject.ModelTag = "SunSensorBoresight"
sszBACObject.boreVec_B = [0., 0., 1.] # boresight in body frame
scSim.AddModelToTask(simTaskName, sszBACObject)
#
# Setup data logging before the simulation is initialized
#
numDataPoints = 500
samplingTime = unitTestSupport.samplingTime(simulationTime, simulationTimeStep, numDataPoints)
sNavRec = sNavObject.attOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, sNavRec)
CAMRec = CAM.attRefOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, CAMRec)
dataRec = scObject.scStateOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, dataRec)
rwMotorLog = rwMotorTorqueObj.rwMotorTorqueOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, rwMotorLog)
attErrorLog = attError.attGuidOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, attErrorLog)
stBACOLog = stBACObject.angOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, stBACOLog)
ssyBACOLog = ssyBACObject.angOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, ssyBACOLog)
if use2SunSensors:
sszBACOLog = sszBACObject.angOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, sszBACOLog)
# To log the RW information, the following code is used:
mrpLog = rwStateEffector.rwSpeedOutMsg.recorder(samplingTime)
scSim.AddModelToTask(simTaskName, mrpLog)
# A message is created that stores an array of the Omega wheel speeds
rwLogs = []
for item in range(numRW):
rwLogs.append(rwStateEffector.rwOutMsgs[item].recorder(samplingTime))
scSim.AddModelToTask(simTaskName, rwLogs[item])
#
# create simulation messages
#
# create the FSW vehicle configuration message
# use the same inertia in the FSW algorithm as in the simulation
vehicleConfigOut = messaging.VehicleConfigMsgPayload(ISCPntB_B=I)
vcMsg = messaging.VehicleConfigMsg().write(vehicleConfigOut)
# Setup the FSW RW configuration message.
fswRwParamMsg = rwFactory.getConfigMessage()
# link messages
attError.attNavInMsg.subscribeTo(sNavObject.attOutMsg)
sNavObject.scStateInMsg.subscribeTo(scObject.scStateOutMsg)
CAM.scStateInMsg.subscribeTo(scObject.scStateOutMsg)
CAM.vehicleConfigInMsg.subscribeTo(vcMsg)
CAM.keepOutCelBodyInMsg.subscribeTo(spiceObject.planetStateOutMsgs[1])
CAM.keepInCelBodyInMsg.subscribeTo(spiceObject.planetStateOutMsgs[1])
attError.attNavInMsg.subscribeTo(sNavObject.attOutMsg)
attError.attRefInMsg.subscribeTo(CAM.attRefOutMsg)
mrpControl.guidInMsg.subscribeTo(attError.attGuidOutMsg)
mrpControl.vehConfigInMsg.subscribeTo(vcMsg)
mrpControl.rwParamsInMsg.subscribeTo(fswRwParamMsg)
mrpControl.rwSpeedsInMsg.subscribeTo(rwStateEffector.rwSpeedOutMsg)
rwMotorTorqueObj.rwParamsInMsg.subscribeTo(fswRwParamMsg)
rwMotorTorqueObj.vehControlInMsg.subscribeTo(mrpControl.cmdTorqueOutMsg)
rwStateEffector.rwMotorCmdInMsg.subscribeTo(rwMotorTorqueObj.rwMotorTorqueOutMsg)
# Boresight modules
stBACObject.scStateInMsg.subscribeTo(scObject.scStateOutMsg)
stBACObject.celBodyInMsg.subscribeTo(spiceObject.planetStateOutMsgs[1])
ssyBACObject.scStateInMsg.subscribeTo(scObject.scStateOutMsg)
ssyBACObject.celBodyInMsg.subscribeTo(spiceObject.planetStateOutMsgs[1])
if use2SunSensors:
sszBACObject.scStateInMsg.subscribeTo(scObject.scStateOutMsg)
sszBACObject.celBodyInMsg.subscribeTo(spiceObject.planetStateOutMsgs[1])
# Vizard Visualization Option
# ---------------------------
if vizSupport.vizFound:
viz = vizSupport.enableUnityVisualization(scSim, simTaskName, scObject,
# saveFile=__file__
)
vizSupport.createConeInOut(viz, toBodyName='sun_planet_data', coneColor = 'r',
normalVector_B=[1, 0, 0], incidenceAngle=starTrackerFov*macros.D2R, isKeepIn=False,
coneHeight=10.0, coneName='sunKeepOut')
vizSupport.createConeInOut(viz, toBodyName='sun_planet_data', coneColor = 'g',
normalVector_B=[0, 1, 0], incidenceAngle=sunSensorFov*macros.D2R, isKeepIn=True,
coneHeight=10.0, coneName='sunKeepIn')
if use2SunSensors:
vizSupport.createConeInOut(viz, toBodyName='sun_planet_data', coneColor = 'b',
normalVector_B=[0, 0, 1], incidenceAngle=sunSensorFov*macros.D2R, isKeepIn=True,
coneHeight=10.0, coneName='sunKeepIn')
# initialize Simulation: This function runs the self_init()
# cross_init() and reset() routines on each module.
scSim.InitializeSimulation()
# configure a simulation stop time and execute the simulation run
scSim.ConfigureStopTime(simulationTime)
scSim.ExecuteSimulation()
# retrieve the logged data
# RW
dataUsReq = rwMotorLog.motorTorque
dataSigmaBR = attErrorLog.sigma_BR
dataOmegaBR = attErrorLog.omega_BR_B
dataOmegaRW = mrpLog.wheelSpeeds
dataSTMissAngle = stBACOLog.missAngle
dataSSyMissAngle = ssyBACOLog.missAngle
if use2SunSensors:
dataSSzMissAngle = sszBACOLog.missAngle
dataRW = []
for i in range(numRW):
dataRW.append(rwLogs[i].u_current)
np.set_printoptions(precision=16)
# Displays the plots relative to the S/C attitude, maneuver, RW speeds and torques and boresight angles
timeData = rwMotorLog.times() * macros.NANO2MIN
plot_attitude_error(timeData, dataSigmaBR)
figureList = {}
pltName = fileName + "1" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(1)
plot_rw_motor_torque(timeData, dataUsReq, dataRW, numRW)
pltName = fileName + "2" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(2)
plot_rate_error(timeData, dataOmegaBR)
pltName = fileName + "3" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(3)
plot_rw_speeds(timeData, dataOmegaRW, numRW)
pltName = fileName + "4" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(4)
plot_st_miss_angle(timeData, dataSTMissAngle, starTrackerFov)
pltName = fileName + "5" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(5)
dataSS = [dataSSyMissAngle]
if use2SunSensors:
dataSS.append(dataSSzMissAngle)
plot_ss_miss_angle(timeData, dataSS, sunSensorFov)
pltName = fileName + "6" + str(int(use2SunSensors)) + str(starTrackerFov) + str(sunSensorFov) + str(attitudeSetCase)
figureList[pltName] = plt.figure(6)
if show_plots:
plt.show()
# close the plots being saved off to avoid over-writing old and new figures
plt.close("all")
return figureList
# Plotting RW functions
[docs]
def plot_attitude_error(timeData, dataSigmaBR):
"""Plot the attitude errors."""
plt.figure(1)
for idx in range(3):
plt.plot(timeData, dataSigmaBR[:, idx],
color=unitTestSupport.getLineColor(idx, 3),
label=r'$\sigma_' + str(idx) + '$')
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel(r'Attitude Error $\sigma_{B/R}$')
[docs]
def plot_rw_cmd_torque(timeData, dataUsReq, numRW):
"""Plot the RW command torques."""
plt.figure(2)
for idx in range(3):
plt.plot(timeData, dataUsReq[:, idx],
'--',
color=unitTestSupport.getLineColor(idx, numRW),
label=r'$\hat u_{s,' + str(idx) + '}$')
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('RW Motor Torque (Nm)')
[docs]
def plot_rw_motor_torque(timeData, dataUsReq, dataRW, numRW):
"""Plot the RW actual motor torques."""
plt.figure(2)
for idx in range(3):
plt.plot(timeData, dataUsReq[:, idx],
'--',
color=unitTestSupport.getLineColor(idx, numRW),
label=r'$\hat u_{s,' + str(idx) + '}$')
plt.plot(timeData, dataRW[idx],
color=unitTestSupport.getLineColor(idx, numRW),
label='$u_{s,' + str(idx) + '}$')
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('RW Motor Torque (Nm)')
[docs]
def plot_rate_error(timeData, dataOmegaBR):
"""Plot the body angular velocity rate tracking errors."""
plt.figure(3)
for idx in range(3):
plt.plot(timeData, dataOmegaBR[:, idx],
color=unitTestSupport.getLineColor(idx, 3),
label=r'$\omega_{BR,' + str(idx) + '}$')
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('Rate Tracking Error (rad/s) ')
[docs]
def plot_rw_speeds(timeData, dataOmegaRW, numRW):
"""Plot the RW spin rates."""
plt.figure(4)
for idx in range(numRW):
plt.plot(timeData, dataOmegaRW[:, idx] / macros.RPM,
color=unitTestSupport.getLineColor(idx, numRW),
label=r'$\Omega_{' + str(idx) + '}$')
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('RW Speed (RPM) ')
[docs]
def plot_st_miss_angle(timeData, dataMissAngle, Fov):
"""Plot the miss angle between star tacker boresight and Sun."""
fig, ax = plt.subplots()
trans = mtransforms.blended_transform_factory(ax.transData, ax.transAxes)
dataFov = np.ones(len(timeData))*Fov
plt.plot(timeData, dataFov, '--',
color = 'r', label = r'f.o.v.')
data = dataMissAngle*macros.R2D
for idx in range(1):
plt.plot(timeData, data,
color=unitTestSupport.getLineColor(idx, 3),
label=r'$\alpha $')
plt.fill_between(timeData, 0, 1, where=dataFov >= data, facecolor='red',
alpha = 0.4, interpolate=True, transform = trans)
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('StarTracker/Sun angle \u03B1 (deg)')
[docs]
def plot_ss_miss_angle(timeData, dataMissAngle, Fov):
"""Plot the miss angle between sun sensor(s) boresight and Sun."""
fig, ax = plt.subplots()
trans = mtransforms.blended_transform_factory(ax.transData, ax.transAxes)
dataFov = np.ones(len(timeData))*Fov
plt.plot(timeData, dataFov, '--',
color = 'r', label = r'f.o.v.')
data = []
for d in dataMissAngle:
data.append(d*macros.R2D)
for idx in range(len(data)):
plt.plot(timeData, data[idx],
color=unitTestSupport.getLineColor(idx, 3),
label=r'$\beta_{' + str(idx+1) + '}$')
dataMinAngle = 180*np.ones(len(timeData))
for i in range(len(timeData)):
for j in range(len(data)):
if data[j][i] < dataMinAngle[i]:
dataMinAngle[i] = data[j][i]
plt.fill_between(timeData, 0, 1, where = dataFov < dataMinAngle, facecolor='red',
alpha = 0.4, interpolate=True, transform = trans)
plt.legend(loc='lower right')
plt.xlabel('Time [min]')
plt.ylabel('SunSensor/Sun angle \u03B2 (deg)')
if __name__ == "__main__":
run(
True, # show_plots
True, # use2SunSensors
30, # starTrackerFov
70, # sunSensorFov
3 # attitudeSetCase
)